Products 2384700-12-1
CAS 2384700-12-1 is the registry number for 7-[(tert-butoxy)carbonyl]-2-oxa-7-azaspiro[3.5]nonane-5-carboxylic acid, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg.
7-[(2-methylpropan-2-yl)oxycarbonyl]-2-oxa-7-azaspiro[3.5]nonane-5-carboxylic acid (CAS 2384700-12-1) is a chemical compound with the molecular formula C13H21NO5 and a molecular weight of 271.31 g/mol. IUPAC name: 7-[(2-methylpropan-2-yl)oxycarbonyl]-2-oxa-7-azaspiro[3.5]nonane-5-carboxylic acid. InChIKey: SJWQAEWQIVQVDQ-UHFFFAOYSA-N.
| Molecular formula | C13H21NO5 |
|---|---|
| Molecular weight | 271.31 g/mol |
| IUPAC name | 7-[(2-methylpropan-2-yl)oxycarbonyl]-2-oxa-7-azaspiro[3.5]nonane-5-carboxylic acid |
| InChIKey | SJWQAEWQIVQVDQ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC2(COC2)C(C1)C(=O)O |
Computed by PubChem (NCBI)