Products 2385010-27-3
CAS 2385010-27-3 appears in our catalog under these names: 2-Chloro-5,6,7,8-tetrahydro-4,6-dimethylquinoline, 97%, 2-chloro-4,6-dimethyl-5,6,7,8-tetrahydroquinoline, 95%. Offered by: Fluorochem, Chemat. Available pack sizes: 100mg, 250mg, 1g.
2-chloro-4,6-dimethyl-5,6,7,8-tetrahydroquinoline (CAS 2385010-27-3) is a chemical compound with the molecular formula C11H14ClN and a molecular weight of 195.69 g/mol. IUPAC name: 2-chloro-4,6-dimethyl-5,6,7,8-tetrahydroquinoline. InChIKey: MZXCRKHXUNOQRM-UHFFFAOYSA-N.
| Molecular formula | C11H14ClN |
|---|---|
| Molecular weight | 195.69 g/mol |
| IUPAC name | 2-chloro-4,6-dimethyl-5,6,7,8-tetrahydroquinoline |
| InChIKey | MZXCRKHXUNOQRM-UHFFFAOYSA-N |
| SMILES | CC1CCC2=C(C1)C(=CC(=N2)Cl)C |
Computed by PubChem (NCBI)