Products 2385277-97-2
CAS 2385277-97-2 is the registry number for 5-Bromoquinoline-7-carboxylic Acid, ≥95%. Offered by: Chemat. Available pack sizes: 100mg.
5-bromoquinoline-7-carboxylic acid (CAS 2385277-97-2) is a chemical compound with the molecular formula C10H6BrNO2 and a molecular weight of 252.06 g/mol. IUPAC name: 5-bromoquinoline-7-carboxylic acid. InChIKey: GQTCCINEYRXYJA-UHFFFAOYSA-N.
| Molecular formula | C10H6BrNO2 |
|---|---|
| Molecular weight | 252.06 g/mol |
| IUPAC name | 5-bromoquinoline-7-carboxylic acid |
| InChIKey | GQTCCINEYRXYJA-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C(C=C2Br)C(=O)O)N=C1 |
Computed by PubChem (NCBI)