Products 2385514-90-7
CAS 2385514-90-7 is the registry number for 1-Bromo-3-chloro-4-ethoxy-2-methoxybenzene, ≥95%, ≥95%. Offered by: Chemat. Available pack sizes: 1g.
1-bromo-3-chloro-4-ethoxy-2-methoxybenzene (CAS 2385514-90-7) is a chemical compound with the molecular formula C9H10BrClO2 and a molecular weight of 265.53 g/mol. IUPAC name: 1-bromo-3-chloro-4-ethoxy-2-methoxybenzene. InChIKey: XMDCSTIQRCFTNQ-UHFFFAOYSA-N.
| Molecular formula | C9H10BrClO2 |
|---|---|
| Molecular weight | 265.53 g/mol |
| IUPAC name | 1-bromo-3-chloro-4-ethoxy-2-methoxybenzene |
| InChIKey | XMDCSTIQRCFTNQ-UHFFFAOYSA-N |
| SMILES | CCOC1=C(C(=C(C=C1)Br)OC)Cl |
Computed by PubChem (NCBI)