CAS 54370-01-3 appears in our catalog under these names: 1-Bromo-2-(chloromethyl)-4,5-dimethoxybenzene, 95%, 1-Bromo-2-(chloromethyl)-4,5-dimethoxybenzene 95%, 1-Bromo-2-(chloromethyl)-4,5-dimethoxybenzene, 95%, 95%, 1-Bromo-2-(chloromethyl)-4,5-dimethoxybenzene, 98%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 250mg, 100mg.
1-bromo-2-(chloromethyl)-4,5-dimethoxybenzene (CAS 54370-01-3) is a chemical compound with the molecular formula C9H10BrClO2 and a molecular weight of 265.53 g/mol. IUPAC name: 1-bromo-2-(chloromethyl)-4,5-dimethoxybenzene. InChIKey: GJOPMIJUVCIPIZ-UHFFFAOYSA-N.
| Molecular formula | C9H10BrClO2 |
|---|---|
| Molecular weight | 265.53 g/mol |
| IUPAC name | 1-bromo-2-(chloromethyl)-4,5-dimethoxybenzene |
| InChIKey | GJOPMIJUVCIPIZ-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C(=C1)CCl)Br)OC |
Computed by PubChem (NCBI)