Products 2385914-98-5
CAS 2385914-98-5 is the registry number for Tert-Butyl 3-Methyl-3-(Pyridin-3-Yl)Pyrrolidine-1-Carboxylate, 98%. Offered by: Chemat. Available pack sizes: 25mg, 50mg, 100mg, 250mg.
Tert-butyl 3-methyl-3-pyridin-3-ylpyrrolidine-1-carboxylate (CAS 2385914-98-5) is a chemical compound with the molecular formula C15H22N2O2 and a molecular weight of 262.35 g/mol. IUPAC name: tert-butyl 3-methyl-3-pyridin-3-ylpyrrolidine-1-carboxylate. InChIKey: XURQPEPTLPCKTN-UHFFFAOYSA-N.
| Molecular formula | C15H22N2O2 |
|---|---|
| Molecular weight | 262.35 g/mol |
| IUPAC name | tert-butyl 3-methyl-3-pyridin-3-ylpyrrolidine-1-carboxylate |
| InChIKey | XURQPEPTLPCKTN-UHFFFAOYSA-N |
| SMILES | CC1(CCN(C1)C(=O)OC(C)(C)C)C2=CN=CC=C2 |
Computed by PubChem (NCBI)