Products 2386687-62-1
CAS 2386687-62-1 appears in our catalog under these names: Tert-Butyl 4-Iodopicolinate, 98%, 98%, tert-Butyl 4-iodopicolinate, 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
Tert-butyl 4-iodopyridine-2-carboxylate (CAS 2386687-62-1) is a chemical compound with the molecular formula C10H12INO2 and a molecular weight of 305.11 g/mol. IUPAC name: tert-butyl 4-iodopyridine-2-carboxylate. InChIKey: WICKDHDWLWNCDK-UHFFFAOYSA-N.
| Molecular formula | C10H12INO2 |
|---|---|
| Molecular weight | 305.11 g/mol |
| IUPAC name | tert-butyl 4-iodopyridine-2-carboxylate |
| InChIKey | WICKDHDWLWNCDK-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)C1=NC=CC(=C1)I |
Computed by PubChem (NCBI)