Products 2387019-64-7

CAS 2387019-64-7 is the registry number for ethyl 5-tert-butylpicolinate, 95%, 95%. Offered by: Chemat. Available pack sizes: 1g.

Structural formula: {0} (CAS {1})

Ethyl 5-tert-butylpyridine-2-carboxylate (CAS 2387019-64-7) is a chemical compound with the molecular formula C12H17NO2 and a molecular weight of 207.27 g/mol. IUPAC name: ethyl 5-tert-butylpyridine-2-carboxylate. InChIKey: RJCSWPCYDGVASV-UHFFFAOYSA-N.

Identity
Molecular formulaC12H17NO2
Molecular weight207.27 g/mol
IUPAC nameethyl 5-tert-butylpyridine-2-carboxylate
InChIKeyRJCSWPCYDGVASV-UHFFFAOYSA-N
SMILESCCOC(=O)C1=NC=C(C=C1)C(C)(C)C

Computed by PubChem (NCBI)