CAS 2387019-64-7 is the registry number for ethyl 5-tert-butylpicolinate, 95%, 95%. Offered by: Chemat. Available pack sizes: 1g.
Ethyl 5-tert-butylpyridine-2-carboxylate (CAS 2387019-64-7) is a chemical compound with the molecular formula C12H17NO2 and a molecular weight of 207.27 g/mol. IUPAC name: ethyl 5-tert-butylpyridine-2-carboxylate. InChIKey: RJCSWPCYDGVASV-UHFFFAOYSA-N.
| Molecular formula | C12H17NO2 |
|---|---|
| Molecular weight | 207.27 g/mol |
| IUPAC name | ethyl 5-tert-butylpyridine-2-carboxylate |
| InChIKey | RJCSWPCYDGVASV-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=NC=C(C=C1)C(C)(C)C |
Computed by PubChem (NCBI)