CAS 238754-67-1 appears in our catalog under these names: 3–Fluoro–4–(trifluoromethyl)phenylacetic acid, 3-Fluoro-4-(trifluoromethyl)phenylacetic acid, 98%, 98%, 3-Fluoro-4-(trifluoromethyl)phenylacetic acid, 98%. Offered by: GLPBio, Chemat, Fluorochem, Ambeed. Available pack sizes: 1g, 25g, 5g, 250mg, 10g, 50g, 100g.
2-[3-fluoro-4-(trifluoromethyl)phenyl]acetic acid (CAS 238754-67-1) is a chemical compound with the molecular formula C9H6F4O2 and a molecular weight of 222.14 g/mol. IUPAC name: 2-[3-fluoro-4-(trifluoromethyl)phenyl]acetic acid. InChIKey: ZFOWDXKJQNNLMW-UHFFFAOYSA-N.
| Molecular formula | C9H6F4O2 |
|---|---|
| Molecular weight | 222.14 g/mol |
| IUPAC name | 2-[3-fluoro-4-(trifluoromethyl)phenyl]acetic acid |
| InChIKey | ZFOWDXKJQNNLMW-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1CC(=O)O)F)C(F)(F)F |
Computed by PubChem (NCBI)