CAS 2387560-12-3 is the registry number for Benzyl (S)-2-(trifluoromethyl)piperazine-1-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Benzyl (2S)-2-(trifluoromethyl)piperazine-1-carboxylate (CAS 2387560-12-3) is a chemical compound with the molecular formula C13H15F3N2O2 and a molecular weight of 288.27 g/mol. IUPAC name: benzyl (2S)-2-(trifluoromethyl)piperazine-1-carboxylate. InChIKey: LQRIKYHOBGGNAB-NSHDSACASA-N.
| Molecular formula | C13H15F3N2O2 |
|---|---|
| Molecular weight | 288.27 g/mol |
| IUPAC name | benzyl (2S)-2-(trifluoromethyl)piperazine-1-carboxylate |
| InChIKey | LQRIKYHOBGGNAB-NSHDSACASA-N |
| SMILES | C1CN([C@@H](CN1)C(F)(F)F)C(=O)OCC2=CC=CC=C2 |
Computed by PubChem (NCBI)