CAS 677704-61-9 appears in our catalog under these names: 4-(4-Methylpiperazin-1-yl)-3-(trifluoromethyl)benzoic acid, 97%, 4-(4-Methylpiperazin-1-yl)-3-(trifluoromethyl)benzoic acid, 96%, 96%, 4-(4-Methylpiperazin-1-yl)-3-(trifluoromethyl)benzoic acid, 96%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 100mg, 5g, 250mg, 1g.
4-(4-methylpiperazin-1-yl)-3-(trifluoromethyl)benzoic acid (CAS 677704-61-9) is a chemical compound with the molecular formula C13H15F3N2O2 and a molecular weight of 288.27 g/mol. IUPAC name: 4-(4-methylpiperazin-1-yl)-3-(trifluoromethyl)benzoic acid. InChIKey: HKXLQXGDOXPKNY-UHFFFAOYSA-N.
| Molecular formula | C13H15F3N2O2 |
|---|---|
| Molecular weight | 288.27 g/mol |
| IUPAC name | 4-(4-methylpiperazin-1-yl)-3-(trifluoromethyl)benzoic acid |
| InChIKey | HKXLQXGDOXPKNY-UHFFFAOYSA-N |
| SMILES | CN1CCN(CC1)C2=C(C=C(C=C2)C(=O)O)C(F)(F)F |
Computed by PubChem (NCBI)