CAS 2387563-74-6 appears in our catalog under these names: (4R)-8-azaspiro[4.5]decan-4-ol,hydrochloride, 97%, 97%, (4R)-8-azaspiro[4.5]decan-4-ol,hydrochloride, 97%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 500mg, 1g.
(4R)-8-azaspiro[4.5]decan-4-ol;hydrochloride (CAS 2387563-74-6) is a chemical compound with the molecular formula C9H18ClNO and a molecular weight of 191.70 g/mol. IUPAC name: (4R)-8-azaspiro[4.5]decan-4-ol;hydrochloride. InChIKey: LRQGIPDIBUHQFP-DDWIOCJRSA-N.
| Molecular formula | C9H18ClNO |
|---|---|
| Molecular weight | 191.70 g/mol |
| IUPAC name | (4R)-8-azaspiro[4.5]decan-4-ol;hydrochloride |
| InChIKey | LRQGIPDIBUHQFP-DDWIOCJRSA-N |
| SMILES | C1C[C@H](C2(C1)CCNCC2)O.Cl |
Computed by PubChem (NCBI)