CAS 2387600-82-8 is the registry number for 2-(Methoxycarbonyl)-5-oxo-5H-thiazolo[3,2-a]pyridine-8-carboxylic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
2-methoxycarbonyl-5-oxo-[1,3]thiazolo[3,2-a]pyridine-8-carboxylic acid (CAS 2387600-82-8) is a chemical compound with the molecular formula C10H7NO5S and a molecular weight of 253.23 g/mol. IUPAC name: 2-methoxycarbonyl-5-oxo-[1,3]thiazolo[3,2-a]pyridine-8-carboxylic acid. InChIKey: XBXIFJDDXFSUMP-UHFFFAOYSA-N.
| Molecular formula | C10H7NO5S |
|---|---|
| Molecular weight | 253.23 g/mol |
| IUPAC name | 2-methoxycarbonyl-5-oxo-[1,3]thiazolo[3,2-a]pyridine-8-carboxylic acid |
| InChIKey | XBXIFJDDXFSUMP-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CN2C(=O)C=CC(=C2S1)C(=O)O |
Computed by PubChem (NCBI)