CAS 3682-32-4 appears in our catalog under these names: 4–Hydroxy–3–nitroso–1–naphthalenesulfonic Acid Hydrate, 4-Hydroxy-3-nitroso-1-naphthalenesulfonic Acid, >98.0%(T)(HPLC), 4-Hydroxy-3-nitrosonaphthalene-1-sulfonic acid, 98.0%, 98.0%. Offered by: GLPBio, TCI, Chemat. Available pack sizes: 5g, 25g.
4-hydroxy-3-nitrosonaphthalene-1-sulfonic acid (CAS 3682-32-4) is a chemical compound with the molecular formula C10H7NO5S and a molecular weight of 253.23 g/mol. IUPAC name: 4-hydroxy-3-nitrosonaphthalene-1-sulfonic acid. InChIKey: GASPSNIEUBWWJU-UHFFFAOYSA-N.
| Molecular formula | C10H7NO5S |
|---|---|
| Molecular weight | 253.23 g/mol |
| IUPAC name | 4-hydroxy-3-nitrosonaphthalene-1-sulfonic acid |
| InChIKey | GASPSNIEUBWWJU-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=CC(=C2O)N=O)S(=O)(=O)O |
Computed by PubChem (NCBI)