CAS 2389017-86-9 appears in our catalog under these names: 2-Bromo-5-(4h-1,2,4-triazol-4-yl)pyrazine, 95%, 2-Bromo-5-(4H-1,2,4-triazol-4-yl)pyrazine, ≥98%, ≥98%. Offered by: Combi-blocks, Chemat. Available pack sizes: 250mg, 1g, 100mg.
2-bromo-5-(1,2,4-triazol-4-yl)pyrazine (CAS 2389017-86-9) is a chemical compound with the molecular formula C6H4BrN5 and a molecular weight of 226.03 g/mol. IUPAC name: 2-bromo-5-(1,2,4-triazol-4-yl)pyrazine. InChIKey: XEHCPJMUIPSGGY-UHFFFAOYSA-N.
| Molecular formula | C6H4BrN5 |
|---|---|
| Molecular weight | 226.03 g/mol |
| IUPAC name | 2-bromo-5-(1,2,4-triazol-4-yl)pyrazine |
| InChIKey | XEHCPJMUIPSGGY-UHFFFAOYSA-N |
| SMILES | C1=C(N=CC(=N1)Br)N2C=NN=C2 |
Computed by PubChem (NCBI)