CAS 883230-70-4 is the registry number for 5-Bromo-2-(1H-1,2,4-triazol-1-yl)pyrimidine, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
5-bromo-2-(1,2,4-triazol-1-yl)pyrimidine (CAS 883230-70-4) is a chemical compound with the molecular formula C6H4BrN5 and a molecular weight of 226.03 g/mol. IUPAC name: 5-bromo-2-(1,2,4-triazol-1-yl)pyrimidine. InChIKey: SJRDIAYMEGUQCM-UHFFFAOYSA-N.
| Molecular formula | C6H4BrN5 |
|---|---|
| Molecular weight | 226.03 g/mol |
| IUPAC name | 5-bromo-2-(1,2,4-triazol-1-yl)pyrimidine |
| InChIKey | SJRDIAYMEGUQCM-UHFFFAOYSA-N |
| SMILES | C1=C(C=NC(=N1)N2C=NC=N2)Br |
Computed by PubChem (NCBI)