CAS 239-30-5 is the registry number for 35969, Benzo[b]naphtho[2,1-d]furan (puri. Offered by: Sigma-Aldrich. Available pack sizes: 10MG.
Naphtho[1,2-b][1]benzofuran (CAS 239-30-5) is a chemical compound with the molecular formula C16H10O and a molecular weight of 218.25 g/mol. IUPAC name: naphtho[1,2-b][1]benzofuran. InChIKey: BCBSVZISIWCHFM-UHFFFAOYSA-N.
| Molecular formula | C16H10O |
|---|---|
| Molecular weight | 218.25 g/mol |
| IUPAC name | naphtho[1,2-b][1]benzofuran |
| InChIKey | BCBSVZISIWCHFM-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=CC3=C2OC4=CC=CC=C34 |
Computed by PubChem (NCBI)