CAS 243-42-5 is the registry number for Naphtho(2,3-b)benzofuran. Offered by: TRC. Available pack sizes: 250mg.
Naphtho[2,3-b][1]benzofuran (CAS 243-42-5) is a chemical compound with the molecular formula C16H10O and a molecular weight of 218.25 g/mol. IUPAC name: naphtho[2,3-b][1]benzofuran. InChIKey: FTMRMQALUDDFQO-UHFFFAOYSA-N.
| Molecular formula | C16H10O |
|---|---|
| Molecular weight | 218.25 g/mol |
| IUPAC name | naphtho[2,3-b][1]benzofuran |
| InChIKey | FTMRMQALUDDFQO-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C=C3C(=CC2=C1)C4=CC=CC=C4O3 |
Computed by PubChem (NCBI)