Products 2390512-92-0
CAS 2390512-92-0 is the registry number for Methyl 2-amino-4-(pentafluoro-λ6-sulfanyl)benzoate, 98%. Offered by: Fluorochem. Available pack sizes: 100mg, 250mg.
Methyl 2-amino-4-(pentafluoro-lambda6-sulfanyl)benzoate (CAS 2390512-92-0) is a chemical compound with the molecular formula C8H8F5NO2S and a molecular weight of 277.21 g/mol. IUPAC name: methyl 2-amino-4-(pentafluoro-lambda6-sulfanyl)benzoate. InChIKey: CGGIJXLMHSNBMD-UHFFFAOYSA-N.
| Molecular formula | C8H8F5NO2S |
|---|---|
| Molecular weight | 277.21 g/mol |
| IUPAC name | methyl 2-amino-4-(pentafluoro-lambda6-sulfanyl)benzoate |
| InChIKey | CGGIJXLMHSNBMD-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C=C(C=C1)S(F)(F)(F)(F)F)N |
Computed by PubChem (NCBI)