CAS 239135-52-5 appears in our catalog under these names: 5-Fluoro-2-(trifluoromethyl)phenylacetic acid, 97%, 2-(5-Fluoro-2-(trifluoromethyl)phenyl)acetic acid, 98%, 98%. Offered by: Fluorochem, Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g.
2-[5-fluoro-2-(trifluoromethyl)phenyl]acetic acid (CAS 239135-52-5) is a chemical compound with the molecular formula C9H6F4O2 and a molecular weight of 222.14 g/mol. IUPAC name: 2-[5-fluoro-2-(trifluoromethyl)phenyl]acetic acid. InChIKey: GWWZRGDMAFXULO-UHFFFAOYSA-N.
| Molecular formula | C9H6F4O2 |
|---|---|
| Molecular weight | 222.14 g/mol |
| IUPAC name | 2-[5-fluoro-2-(trifluoromethyl)phenyl]acetic acid |
| InChIKey | GWWZRGDMAFXULO-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1F)CC(=O)O)C(F)(F)F |
Computed by PubChem (NCBI)