CAS 2396-05-6 appears in our catalog under these names: 1-(4-Dimethylaminophenyl)-2,2,2-trifluoroethanone, 95%, 1-(4-(Dimethylamino)phenyl)-2,2,2-trifluoroethanone 95%, 4'-(DIMETHYLAMINO)-2,2,2-TRIFLUOROACETO&, 1-(4-(Dimethylamino)phenyl)-2，2，2-trifluoroethanone, 95%, 95%. Offered by: Combi-blocks, Ambeed, Sigma-Aldrich, Chemat. Available pack sizes: 1g, 250mg, 5g, 10g.
1-[4-(dimethylamino)phenyl]-2,2,2-trifluoroethanone (CAS 2396-05-6) is a chemical compound with the molecular formula C10H10F3NO and a molecular weight of 217.19 g/mol. IUPAC name: 1-[4-(dimethylamino)phenyl]-2,2,2-trifluoroethanone. InChIKey: NDKSWWUQHXZADC-UHFFFAOYSA-N.
| Molecular formula | C10H10F3NO |
|---|---|
| Molecular weight | 217.19 g/mol |
| IUPAC name | 1-[4-(dimethylamino)phenyl]-2,2,2-trifluoroethanone |
| InChIKey | NDKSWWUQHXZADC-UHFFFAOYSA-N |
| SMILES | CN(C)C1=CC=C(C=C1)C(=O)C(F)(F)F |
Computed by PubChem (NCBI)