Products 2396612-00-1
CAS 2396612-00-1 is the registry number for Xanthine oxidoreductase-IN-1. Offered by: MedChemExpress. Available pack sizes: Get quote.
1-[4-(azocan-1-yl)-3-cyanophenyl]imidazole-4-carboxylic acid (CAS 2396612-00-1) is a chemical compound with the molecular formula C18H20N4O2 and a molecular weight of 324.4 g/mol. IUPAC name: 1-[4-(azocan-1-yl)-3-cyanophenyl]imidazole-4-carboxylic acid. InChIKey: VSOWRGWXUWFZJF-UHFFFAOYSA-N.
| Molecular formula | C18H20N4O2 |
|---|---|
| Molecular weight | 324.4 g/mol |
| IUPAC name | 1-[4-(azocan-1-yl)-3-cyanophenyl]imidazole-4-carboxylic acid |
| InChIKey | VSOWRGWXUWFZJF-UHFFFAOYSA-N |
| SMILES | C1CCCN(CCC1)C2=C(C=C(C=C2)N3C=C(N=C3)C(=O)O)C#N |
Computed by PubChem (NCBI)
Synonyms:
Xanthine oxidoreductase-IN-1, orb1689143