CAS 2396741-03-8 appears in our catalog under these names: (S)-(4-(Prop-1-en-2-yl)cyclohex-1-en-1-yl)methyl acrylate, 95%, 95%, (S)-(4-(Prop-1-en-2-yl)cyclohex-1-en-1-yl)methyl acrylate, 98%, (S)-(4-(Prop-1-en-2-yl)cyclohex-1-en-1-yl)methyl acrylate, 95%. Offered by: Chemat, Fluorochem, Ambeed. Available pack sizes: 50mg, 100mg, 250mg, 1g.
[(4S)-4-prop-1-en-2-ylcyclohexen-1-yl]methyl prop-2-enoate (CAS 2396741-03-8) is a chemical compound with the molecular formula C13H18O2 and a molecular weight of 206.28 g/mol. IUPAC name: [(4S)-4-prop-1-en-2-ylcyclohexen-1-yl]methyl prop-2-enoate. InChIKey: JVRCSVORJIEFMV-GFCCVEGCSA-N.
| Molecular formula | C13H18O2 |
|---|---|
| Molecular weight | 206.28 g/mol |
| IUPAC name | [(4S)-4-prop-1-en-2-ylcyclohexen-1-yl]methyl prop-2-enoate |
| InChIKey | JVRCSVORJIEFMV-GFCCVEGCSA-N |
| SMILES | CC(=C)[C@H]1CCC(=CC1)COC(=O)C=C |
Computed by PubChem (NCBI)