Products 2397556-18-0
CAS 2397556-18-0 is the registry number for Brivaracetam Impurity Q. Offered by: Chemat Brand. Available pack sizes: on request.
(3R)-3-[[[(2S)-1-amino-1-oxobutan-2-yl]amino]methyl]hexanoic acid (CAS 2397556-18-0) is a chemical compound with the molecular formula C11H22N2O3 and a molecular weight of 230.30 g/mol. IUPAC name: (3R)-3-[[[(2S)-1-amino-1-oxobutan-2-yl]amino]methyl]hexanoic acid. InChIKey: BQMYDNIVIMBFIX-BDAKNGLRSA-N.
| Molecular formula | C11H22N2O3 |
|---|---|
| Molecular weight | 230.30 g/mol |
| IUPAC name | (3R)-3-[[[(2S)-1-amino-1-oxobutan-2-yl]amino]methyl]hexanoic acid |
| InChIKey | BQMYDNIVIMBFIX-BDAKNGLRSA-N |
| SMILES | CCC[C@H](CC(=O)O)CN[C@@H](CC)C(=O)N |
Computed by PubChem (NCBI)