Products 2397624-06-3
CAS 2397624-06-3 is the registry number for 5-Amino-4,6-diisopropylpyrimidine-2-carbonitrile, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
5-amino-4,6-di(propan-2-yl)pyrimidine-2-carbonitrile (CAS 2397624-06-3) is a chemical compound with the molecular formula C11H16N4 and a molecular weight of 204.27 g/mol. IUPAC name: 5-amino-4,6-di(propan-2-yl)pyrimidine-2-carbonitrile. InChIKey: QAFVMGNTLBQLMQ-UHFFFAOYSA-N.
| Molecular formula | C11H16N4 |
|---|---|
| Molecular weight | 204.27 g/mol |
| IUPAC name | 5-amino-4,6-di(propan-2-yl)pyrimidine-2-carbonitrile |
| InChIKey | QAFVMGNTLBQLMQ-UHFFFAOYSA-N |
| SMILES | CC(C)C1=C(C(=NC(=N1)C#N)C(C)C)N |
Computed by PubChem (NCBI)