CAS 2763646-30-4 is the registry number for 6-(3-Cyclopropyl-1H-1,2,4-triazol-1-yl)-2-azaspiro[3.3]heptane, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
6-(3-cyclopropyl-1,2,4-triazol-1-yl)-2-azaspiro[3.3]heptane (CAS 2763646-30-4) is a chemical compound with the molecular formula C11H16N4 and a molecular weight of 204.27 g/mol. IUPAC name: 6-(3-cyclopropyl-1,2,4-triazol-1-yl)-2-azaspiro[3.3]heptane. InChIKey: HOFJFVMNBSGQBC-UHFFFAOYSA-N.
| Molecular formula | C11H16N4 |
|---|---|
| Molecular weight | 204.27 g/mol |
| IUPAC name | 6-(3-cyclopropyl-1,2,4-triazol-1-yl)-2-azaspiro[3.3]heptane |
| InChIKey | HOFJFVMNBSGQBC-UHFFFAOYSA-N |
| SMILES | C1CC1C2=NN(C=N2)C3CC4(C3)CNC4 |
Computed by PubChem (NCBI)