CAS 23994-23-2 is the registry number for 3-Phenylisoquinoline-1,4-dione, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
3-phenylisoquinoline-1,4-dione (CAS 23994-23-2) is a chemical compound with the molecular formula C15H9NO2 and a molecular weight of 235.24 g/mol. IUPAC name: 3-phenylisoquinoline-1,4-dione. InChIKey: JWIDPAHGSXXYQZ-UHFFFAOYSA-N.
| Molecular formula | C15H9NO2 |
|---|---|
| Molecular weight | 235.24 g/mol |
| IUPAC name | 3-phenylisoquinoline-1,4-dione |
| InChIKey | JWIDPAHGSXXYQZ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=NC(=O)C3=CC=CC=C3C2=O |
Computed by PubChem (NCBI)