CAS 31083-55-3 appears in our catalog under these names: PRT4165, PRT4165/ 99.6% (existing batch purity), PRT 4165, (2E)-2-(Pyridin-3-ylmethylidene)-2,3-dihydro-1H-indene-1,3-dione, PRT4165 98%. Offered by: Chemat Brand, TargetMol, GLPBio, Biosynth, Ambeed. Available pack sizes: on request, 5mg, 10mg, 25mg, 50mg, 100mg, 200mg, 500mg.
2-(pyridin-3-ylmethylidene)indene-1,3-dione (CAS 31083-55-3) is a chemical compound with the molecular formula C15H9NO2 and a molecular weight of 235.24 g/mol. IUPAC name: 2-(pyridin-3-ylmethylidene)indene-1,3-dione. InChIKey: OMHZFEWYVFWVLI-UHFFFAOYSA-N.
| Molecular formula | C15H9NO2 |
|---|---|
| Molecular weight | 235.24 g/mol |
| IUPAC name | 2-(pyridin-3-ylmethylidene)indene-1,3-dione |
| InChIKey | OMHZFEWYVFWVLI-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=O)C(=CC3=CN=CC=C3)C2=O |
Computed by PubChem (NCBI)