Products 23997-82-2
CAS 23997-82-2 is the registry number for (1E)-1-(2,5-dimethoxyphenyl)ethanone oxime, 97%. Offered by: Chemat. Available pack sizes: 1g, 5g.
(NZ)-N-[1-(2,5-dimethoxyphenyl)ethylidene]hydroxylamine (CAS 23997-82-2) is a chemical compound with the molecular formula C10H13NO3 and a molecular weight of 195.21 g/mol. IUPAC name: (NZ)-N-[1-(2,5-dimethoxyphenyl)ethylidene]hydroxylamine. InChIKey: JDEJVZRCMSXTBW-XFFZJAGNSA-N.
| Molecular formula | C10H13NO3 |
|---|---|
| Molecular weight | 195.21 g/mol |
| IUPAC name | (NZ)-N-[1-(2,5-dimethoxyphenyl)ethylidene]hydroxylamine |
| InChIKey | JDEJVZRCMSXTBW-XFFZJAGNSA-N |
| SMILES | C/C(=N/O)/C1=C(C=CC(=C1)OC)OC |
Computed by PubChem (NCBI)