CAS 240121-55-5 is the registry number for 7-(1H-Benzo(d)imidazol-2-yl)-1,1,1-trifluoroheptan-2-one, 97%. Offered by: AmBeed. Available pack sizes: 5g.
7-(1H-benzimidazol-2-yl)-1,1,1-trifluoroheptan-2-one (CAS 240121-55-5) is a chemical compound with the molecular formula C14H15F3N2O and a molecular weight of 284.28 g/mol. IUPAC name: 7-(1H-benzimidazol-2-yl)-1,1,1-trifluoroheptan-2-one. InChIKey: JPFKHCKWTSXIST-UHFFFAOYSA-N.
| Molecular formula | C14H15F3N2O |
|---|---|
| Molecular weight | 284.28 g/mol |
| IUPAC name | 7-(1H-benzimidazol-2-yl)-1,1,1-trifluoroheptan-2-one |
| InChIKey | JPFKHCKWTSXIST-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)NC(=N2)CCCCCC(=O)C(F)(F)F |
Computed by PubChem (NCBI)