CAS 2446484-53-1 is the registry number for (4-(1-Isopropyl-4-(trifluoromethyl)-1H-imidazol-2-yl)phenyl)methanol, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g.
[4-[1-propan-2-yl-4-(trifluoromethyl)imidazol-2-yl]phenyl]methanol (CAS 2446484-53-1) is a chemical compound with the molecular formula C14H15F3N2O and a molecular weight of 284.28 g/mol. IUPAC name: [4-[1-propan-2-yl-4-(trifluoromethyl)imidazol-2-yl]phenyl]methanol. InChIKey: SSAOUINOERTEEF-UHFFFAOYSA-N.
| Molecular formula | C14H15F3N2O |
|---|---|
| Molecular weight | 284.28 g/mol |
| IUPAC name | [4-[1-propan-2-yl-4-(trifluoromethyl)imidazol-2-yl]phenyl]methanol |
| InChIKey | SSAOUINOERTEEF-UHFFFAOYSA-N |
| SMILES | CC(C)N1C=C(N=C1C2=CC=C(C=C2)CO)C(F)(F)F |
Computed by PubChem (NCBI)