CAS 2404733-81-7 appears in our catalog under these names: 1,2,5-Tribromo-3-isopropylbenzene, 95%, 1,2,5-Tribromo-3-isopropylbenzene. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 5g, 25g, 10g, 1g, 250mg.
1,2,5-tribromo-3-propan-2-ylbenzene (CAS 2404733-81-7) is a chemical compound with the molecular formula C9H9Br3 and a molecular weight of 356.88 g/mol. IUPAC name: 1,2,5-tribromo-3-propan-2-ylbenzene. InChIKey: QPSJNHTXDOFXBO-UHFFFAOYSA-N.
| Molecular formula | C9H9Br3 |
|---|---|
| Molecular weight | 356.88 g/mol |
| IUPAC name | 1,2,5-tribromo-3-propan-2-ylbenzene |
| InChIKey | QPSJNHTXDOFXBO-UHFFFAOYSA-N |
| SMILES | CC(C)C1=C(C(=CC(=C1)Br)Br)Br |
Computed by PubChem (NCBI)