CAS 608-72-0 appears in our catalog under these names: 1,3,5-Tribromo-2,4,6-Trimethylbenzene, 1,3,5–Tribromo–2,4,6–Trimethyl–Benzene, 1,3,5-TribroMo-2,4,6-TriMethyl-Benzene, 1,3,5-Tribromo-2,4,6-trimethylbenzene, >98.0%(GC), 1,3,5-Tribromo-2,4,6-trimethylbenzene 97%. Offered by: TRC, GLPBio, Biosynth, TCI, Ambeed. Available pack sizes: 100mg, 1g, 500mg, 25g, 250mg, 5g, 100g, 500g.
1,3,5-tribromo-2,4,6-trimethylbenzene (CAS 608-72-0) is a chemical compound with the molecular formula C9H9Br3 and a molecular weight of 356.88 g/mol. IUPAC name: 1,3,5-tribromo-2,4,6-trimethylbenzene. InChIKey: LTSSSVHTLGQZAQ-UHFFFAOYSA-N.
| Molecular formula | C9H9Br3 |
|---|---|
| Molecular weight | 356.88 g/mol |
| IUPAC name | 1,3,5-tribromo-2,4,6-trimethylbenzene |
| InChIKey | LTSSSVHTLGQZAQ-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=C(C(=C1Br)C)Br)C)Br |
Computed by PubChem (NCBI)