Products 2404733-94-2

CAS 2404733-94-2 is the registry number for 2-(4-Bromophenyl)-3-chloro-6-methylimidazo[1,2-a]pyridine, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 25g, 10g, 1g, 250mg.

Structural formula: {0} (CAS {1})

2-(4-bromophenyl)-3-chloro-6-methylimidazo[1,2-a]pyridine (CAS 2404733-94-2) is a chemical compound with the molecular formula C14H10BrClN2 and a molecular weight of 321.60 g/mol. IUPAC name: 2-(4-bromophenyl)-3-chloro-6-methylimidazo[1,2-a]pyridine. InChIKey: VOBRRUIFEIDDLP-UHFFFAOYSA-N.

Identity
Molecular formulaC14H10BrClN2
Molecular weight321.60 g/mol
IUPAC name2-(4-bromophenyl)-3-chloro-6-methylimidazo[1,2-a]pyridine
InChIKeyVOBRRUIFEIDDLP-UHFFFAOYSA-N
SMILESCC1=CN2C(=NC(=C2Cl)C3=CC=C(C=C3)Br)C=C1

Computed by PubChem (NCBI)