CAS 910617-51-5 is the registry number for 6-Bromo-2-(4-chlorophenyl)-8-methyl-imidazo[1,2-a]pyridine, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 250mg, 1g.
6-bromo-2-(4-chlorophenyl)-8-methylimidazo[1,2-a]pyridine (CAS 910617-51-5) is a chemical compound with the molecular formula C14H10BrClN2 and a molecular weight of 321.60 g/mol. IUPAC name: 6-bromo-2-(4-chlorophenyl)-8-methylimidazo[1,2-a]pyridine. InChIKey: WOVZSCUIXRFTMU-UHFFFAOYSA-N.
| Molecular formula | C14H10BrClN2 |
|---|---|
| Molecular weight | 321.60 g/mol |
| IUPAC name | 6-bromo-2-(4-chlorophenyl)-8-methylimidazo[1,2-a]pyridine |
| InChIKey | WOVZSCUIXRFTMU-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CN2C1=NC(=C2)C3=CC=C(C=C3)Cl)Br |
Computed by PubChem (NCBI)