Products 24051-35-2
CAS 24051-35-2 is the registry number for 1-(3-Chlorophenyl)pyrrolidin-2-one, 98%. Offered by: Combi-blocks. Available pack sizes: 10g, 1g, 5g.
1-(3-chlorophenyl)pyrrolidin-2-one (CAS 24051-35-2) is a chemical compound with the molecular formula C10H10ClNO and a molecular weight of 195.64 g/mol. IUPAC name: 1-(3-chlorophenyl)pyrrolidin-2-one. InChIKey: AFHUWZFARIICFX-UHFFFAOYSA-N.
| Molecular formula | C10H10ClNO |
|---|---|
| Molecular weight | 195.64 g/mol |
| IUPAC name | 1-(3-chlorophenyl)pyrrolidin-2-one |
| InChIKey | AFHUWZFARIICFX-UHFFFAOYSA-N |
| SMILES | C1CC(=O)N(C1)C2=CC(=CC=C2)Cl |
Computed by PubChem (NCBI)