Products 2407906-63-0
CAS 2407906-63-0 is the registry number for 6-Bromo-4-hydroxy-1-methyl-1,5-naphthyridin-2(1H)-one, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
6-bromo-4-hydroxy-1-methyl-1,5-naphthyridin-2-one (CAS 2407906-63-0) is a chemical compound with the molecular formula C9H7BrN2O2 and a molecular weight of 255.07 g/mol. IUPAC name: 6-bromo-4-hydroxy-1-methyl-1,5-naphthyridin-2-one. InChIKey: GPMDOWAGWZUVNQ-UHFFFAOYSA-N.
| Molecular formula | C9H7BrN2O2 |
|---|---|
| Molecular weight | 255.07 g/mol |
| IUPAC name | 6-bromo-4-hydroxy-1-methyl-1,5-naphthyridin-2-one |
| InChIKey | GPMDOWAGWZUVNQ-UHFFFAOYSA-N |
| SMILES | CN1C2=C(C(=CC1=O)O)N=C(C=C2)Br |
Computed by PubChem (NCBI)