Products 2408053-56-3
CAS 2408053-56-3 appears in our catalog under these names: Sacubitril Impurity 31, Sacubitril methyl ester, 4-(((2S,4R)-1-([1,1'-biphenyl]-4-yl)-5-methoxy-4-methyl-5-oxopentan-2-yl)amino)-4-oxobutanoic acid, 95%, 95%. Offered by: Chemat Brand, Biosynth, Chemat. Available pack sizes: on request, 2mg, 1mg, 5mg, 25mg, 10mg.
4-[[(2S,4R)-5-methoxy-4-methyl-5-oxo-1-(4-phenylphenyl)pentan-2-yl]amino]-4-oxobutanoic acid (CAS 2408053-56-3) is a chemical compound with the molecular formula C23H27NO5 and a molecular weight of 397.5 g/mol. IUPAC name: 4-[[(2S,4R)-5-methoxy-4-methyl-5-oxo-1-(4-phenylphenyl)pentan-2-yl]amino]-4-oxobutanoic acid. InChIKey: YZQPUNBJWCBUJB-UZLBHIALSA-N.
| Molecular formula | C23H27NO5 |
|---|---|
| Molecular weight | 397.5 g/mol |
| IUPAC name | 4-[[(2S,4R)-5-methoxy-4-methyl-5-oxo-1-(4-phenylphenyl)pentan-2-yl]amino]-4-oxobutanoic acid |
| InChIKey | YZQPUNBJWCBUJB-UZLBHIALSA-N |
| SMILES | C[C@H](C[C@@H](CC1=CC=C(C=C1)C2=CC=CC=C2)NC(=O)CCC(=O)O)C(=O)OC |
Computed by PubChem (NCBI)
Synonyms:
Sacubitril Impurity 30, Sacubitril Methyl Ester