Products 2408131-70-2
CAS 2408131-70-2 appears in our catalog under these names: Bempedoic Acid-d4, Bempedoic Acid D4, Bempedoic acid-d4, 98.0%, 98.0%, Bempedoic acid-d4, 98.0%. Offered by: Chemat Brand, TRC, Chemat, MedChemExpress. Available pack sizes: on request, 25mg, 1mg, 1 mg, 5 mg.
7,7,9,9-tetradeuterio-8-hydroxy-2,2,14,14-tetramethylpentadecanedioic acid (CAS 2408131-70-2) is a chemical compound with the molecular formula C19H36O5 and a molecular weight of 348.5 g/mol. IUPAC name: 7,7,9,9-tetradeuterio-8-hydroxy-2,2,14,14-tetramethylpentadecanedioic acid. InChIKey: HYHMLYSLQUKXKP-AREBVXNXSA-N.
| Molecular formula | C19H36O5 |
|---|---|
| Molecular weight | 348.5 g/mol |
| IUPAC name | 7,7,9,9-tetradeuterio-8-hydroxy-2,2,14,14-tetramethylpentadecanedioic acid |
| InChIKey | HYHMLYSLQUKXKP-AREBVXNXSA-N |
| SMILES | [2H]C([2H])(CCCCC(C)(C)C(=O)O)C(C([2H])([2H])CCCCC(C)(C)C(=O)O)O |
Computed by PubChem (NCBI)