Products 2408131-71-3
CAS 2408131-71-3 appears in our catalog under these names: Bempedoic Acid-d5, >95% (HPLC), Bempedoic acid-d5. Offered by: TRC, MedChemExpress. Available pack sizes: 25mg, 50mg, 5mg, 25 mg, 50 mg, 5 mg, 10 mg.
7,7,8,9,9-pentadeuterio-8-hydroxy-2,2,14,14-tetramethylpentadecanedioic acid (CAS 2408131-71-3) is a chemical compound with the molecular formula C19H36O5 and a molecular weight of 349.5 g/mol. IUPAC name: 7,7,8,9,9-pentadeuterio-8-hydroxy-2,2,14,14-tetramethylpentadecanedioic acid. InChIKey: HYHMLYSLQUKXKP-ALWHKASXSA-N.
| Molecular formula | C19H36O5 |
|---|---|
| Molecular weight | 349.5 g/mol |
| IUPAC name | 7,7,8,9,9-pentadeuterio-8-hydroxy-2,2,14,14-tetramethylpentadecanedioic acid |
| InChIKey | HYHMLYSLQUKXKP-ALWHKASXSA-N |
| SMILES | [2H]C([2H])(CCCCC(C)(C)C(=O)O)C([2H])(C([2H])([2H])CCCCC(C)(C)C(=O)O)O |
Computed by PubChem (NCBI)
Synonyms:
Bempedoic Acid-D5, 738606-46-7 (unlabeled)