CAS 2408761-26-0 is the registry number for Methyl 4-((2R,4S)-4-ethoxypiperidin-2-yl)benzoate, 98%. Offered by: AmBeed. Available pack sizes: 1g, 250mg.
Methyl 4-[(2R,4S)-4-ethoxypiperidin-2-yl]benzoate (CAS 2408761-26-0) is a chemical compound with the molecular formula C15H21NO3 and a molecular weight of 263.33 g/mol. IUPAC name: methyl 4-[(2R,4S)-4-ethoxypiperidin-2-yl]benzoate. InChIKey: DZNZBIFPILZUCT-UONOGXRCSA-N.
| Molecular formula | C15H21NO3 |
|---|---|
| Molecular weight | 263.33 g/mol |
| IUPAC name | methyl 4-[(2R,4S)-4-ethoxypiperidin-2-yl]benzoate |
| InChIKey | DZNZBIFPILZUCT-UONOGXRCSA-N |
| SMILES | CCO[C@H]1CCN[C@H](C1)C2=CC=C(C=C2)C(=O)OC |
Computed by PubChem (NCBI)