Products 2408938-66-7
CAS 2408938-66-7 is the registry number for tert-Butyl ((2S,3R)-1-hydroxy-3-methoxybutan-2-yl)carbamate, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl N-[(2S,3R)-1-hydroxy-3-methoxybutan-2-yl]carbamate (CAS 2408938-66-7) is a chemical compound with the molecular formula C10H21NO4 and a molecular weight of 219.28 g/mol. IUPAC name: tert-butyl N-[(2S,3R)-1-hydroxy-3-methoxybutan-2-yl]carbamate. InChIKey: FCAHPLYKWWQRDA-SFYZADRCSA-N.
| Molecular formula | C10H21NO4 |
|---|---|
| Molecular weight | 219.28 g/mol |
| IUPAC name | tert-butyl N-[(2S,3R)-1-hydroxy-3-methoxybutan-2-yl]carbamate |
| InChIKey | FCAHPLYKWWQRDA-SFYZADRCSA-N |
| SMILES | C[C@H]([C@H](CO)NC(=O)OC(C)(C)C)OC |
Computed by PubChem (NCBI)