CAS 305379-00-4 is the registry number for L-ido Miglustat, >95% (HPLC). Offered by: TRC. Available pack sizes: 25mg.
(2S,3R,4R,5S)-1-butyl-2-(hydroxymethyl)piperidine-3,4,5-triol (CAS 305379-00-4) is a chemical compound with the molecular formula C10H21NO4 and a molecular weight of 219.28 g/mol. IUPAC name: (2S,3R,4R,5S)-1-butyl-2-(hydroxymethyl)piperidine-3,4,5-triol. InChIKey: UQRORFVVSGFNRO-AXTSPUMRSA-N.
| Molecular formula | C10H21NO4 |
|---|---|
| Molecular weight | 219.28 g/mol |
| IUPAC name | (2S,3R,4R,5S)-1-butyl-2-(hydroxymethyl)piperidine-3,4,5-triol |
| InChIKey | UQRORFVVSGFNRO-AXTSPUMRSA-N |
| SMILES | CCCCN1C[C@@H]([C@H]([C@@H]([C@@H]1CO)O)O)O |
Computed by PubChem (NCBI)