Products 2408966-52-7

CAS 2408966-52-7 is the registry number for 4-Formylpicolinic acid hydrochloride, 95%. Offered by: AmBeed. Available pack sizes: 250mg, 1g.

Structural formula: {0} (CAS {1})

4-formylpyridine-2-carboxylic acid;hydrochloride (CAS 2408966-52-7) is a chemical compound with the molecular formula C7H6ClNO3 and a molecular weight of 187.58 g/mol. IUPAC name: 4-formylpyridine-2-carboxylic acid;hydrochloride. InChIKey: TVKNINSHBHWCDL-UHFFFAOYSA-N.

Identity
Molecular formulaC7H6ClNO3
Molecular weight187.58 g/mol
IUPAC name4-formylpyridine-2-carboxylic acid;hydrochloride
InChIKeyTVKNINSHBHWCDL-UHFFFAOYSA-N
SMILESC1=CN=C(C=C1C=O)C(=O)O.Cl

Computed by PubChem (NCBI)