CAS 2408966-52-7 is the registry number for 4-Formylpicolinic acid hydrochloride, 95%. Offered by: AmBeed. Available pack sizes: 250mg, 1g.
4-formylpyridine-2-carboxylic acid;hydrochloride (CAS 2408966-52-7) is a chemical compound with the molecular formula C7H6ClNO3 and a molecular weight of 187.58 g/mol. IUPAC name: 4-formylpyridine-2-carboxylic acid;hydrochloride. InChIKey: TVKNINSHBHWCDL-UHFFFAOYSA-N.
| Molecular formula | C7H6ClNO3 |
|---|---|
| Molecular weight | 187.58 g/mol |
| IUPAC name | 4-formylpyridine-2-carboxylic acid;hydrochloride |
| InChIKey | TVKNINSHBHWCDL-UHFFFAOYSA-N |
| SMILES | C1=CN=C(C=C1C=O)C(=O)O.Cl |
Computed by PubChem (NCBI)