Products 2408969-70-8

CAS 2408969-70-8 is the registry number for 4,4-Difluorotetrahydrofuran-3-amine hydrochloride, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g.

Structural formula: {0} (CAS {1})

4,4-difluorooxolan-3-amine;hydrochloride (CAS 2408969-70-8) is a chemical compound with the molecular formula C4H8ClF2NO and a molecular weight of 159.56 g/mol. IUPAC name: 4,4-difluorooxolan-3-amine;hydrochloride. InChIKey: QFYATYIICSINTP-UHFFFAOYSA-N.

Identity
Molecular formulaC4H8ClF2NO
Molecular weight159.56 g/mol
IUPAC name4,4-difluorooxolan-3-amine;hydrochloride
InChIKeyQFYATYIICSINTP-UHFFFAOYSA-N
SMILESC1C(C(CO1)(F)F)N.Cl

Computed by PubChem (NCBI)