Products 2805254-29-7

CAS 2805254-29-7 is the registry number for 3-(difluoromethyl)oxetan-3-amine,hydrochloride, 98%, 98%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g.

Structural formula: {0} (CAS {1})

3-(difluoromethyl)oxetan-3-amine;hydrochloride (CAS 2805254-29-7) is a chemical compound with the molecular formula C4H8ClF2NO and a molecular weight of 159.56 g/mol. IUPAC name: 3-(difluoromethyl)oxetan-3-amine;hydrochloride. InChIKey: FAZRGNCWSUTWGX-UHFFFAOYSA-N.

Identity
Molecular formulaC4H8ClF2NO
Molecular weight159.56 g/mol
IUPAC name3-(difluoromethyl)oxetan-3-amine;hydrochloride
InChIKeyFAZRGNCWSUTWGX-UHFFFAOYSA-N
SMILESC1C(CO1)(C(F)F)N.Cl

Computed by PubChem (NCBI)