Products 2409005-55-4
CAS 2409005-55-4 is the registry number for rel-tert-Butyl ((1R,2R)-2-hydroxy-4,4-dimethylcyclopentyl)carbamate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl N-[(1R,2R)-2-hydroxy-4,4-dimethylcyclopentyl]carbamate (CAS 2409005-55-4) is a chemical compound with the molecular formula C12H23NO3 and a molecular weight of 229.32 g/mol. IUPAC name: tert-butyl N-[(1R,2R)-2-hydroxy-4,4-dimethylcyclopentyl]carbamate. InChIKey: WAQCJEBXHYLXMX-RKDXNWHRSA-N.
| Molecular formula | C12H23NO3 |
|---|---|
| Molecular weight | 229.32 g/mol |
| IUPAC name | tert-butyl N-[(1R,2R)-2-hydroxy-4,4-dimethylcyclopentyl]carbamate |
| InChIKey | WAQCJEBXHYLXMX-RKDXNWHRSA-N |
| SMILES | CC1(C[C@H]([C@@H](C1)O)NC(=O)OC(C)(C)C)C |
Computed by PubChem (NCBI)