CAS 2409110-22-9 is the registry number for (S)-(3-Aminopiperidin-1-yl)(cyclopropyl)methanone hydrochloride, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
[(3S)-3-aminopiperidin-1-yl]-cyclopropylmethanone;hydrochloride (CAS 2409110-22-9) is a chemical compound with the molecular formula C9H17ClN2O and a molecular weight of 204.70 g/mol. IUPAC name: [(3S)-3-aminopiperidin-1-yl]-cyclopropylmethanone;hydrochloride. InChIKey: JAEIACJJXQHUFQ-QRPNPIFTSA-N.
| Molecular formula | C9H17ClN2O |
|---|---|
| Molecular weight | 204.70 g/mol |
| IUPAC name | [(3S)-3-aminopiperidin-1-yl]-cyclopropylmethanone;hydrochloride |
| InChIKey | JAEIACJJXQHUFQ-QRPNPIFTSA-N |
| SMILES | C1C[C@@H](CN(C1)C(=O)C2CC2)N.Cl |
Computed by PubChem (NCBI)