CAS 2409618-74-0 is the registry number for 3',5'-di(Pyridin-3-yl)-[1,1'-biphenyl]-4-carboxylic acid, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
4-(3,5-dipyridin-3-ylphenyl)benzoic acid (CAS 2409618-74-0) is a chemical compound with the molecular formula C23H16N2O2 and a molecular weight of 352.4 g/mol. IUPAC name: 4-(3,5-dipyridin-3-ylphenyl)benzoic acid. InChIKey: CSICKEOEPTUVSP-UHFFFAOYSA-N.
| Molecular formula | C23H16N2O2 |
|---|---|
| Molecular weight | 352.4 g/mol |
| IUPAC name | 4-(3,5-dipyridin-3-ylphenyl)benzoic acid |
| InChIKey | CSICKEOEPTUVSP-UHFFFAOYSA-N |
| SMILES | C1=CC(=CN=C1)C2=CC(=CC(=C2)C3=CC=C(C=C3)C(=O)O)C4=CN=CC=C4 |
Computed by PubChem (NCBI)