Products 2409685-41-0
CAS 2409685-41-0 appears in our catalog under these names: Anti–NASH agent 1, Anti-NASH agent 1, 98.49%, Anti-NASH agent 1, 99%, tert-Butyl 2-(2,6-dimethyl-4-(3-(4-(methylamino)phenyl)-3-oxoprop-1-en-1-yl)phenoxy)-2-methylpropanoate, 99%. Offered by: GLPBio, MedChemExpress, Ambeed, BLDpharm. Available pack sizes: 10mg, 5mg, 10mM (in 1ml dmso), 25 mg, 100 mg, 50 mg, 10mM/1mL, 5 mg.
Tert-butyl 2-[2,6-dimethyl-4-[(E)-3-[4-(methylamino)phenyl]-3-oxoprop-1-enyl]phenoxy]-2-methylpropanoate (CAS 2409685-41-0) is a chemical compound with the molecular formula C26H33NO4 and a molecular weight of 423.5 g/mol. IUPAC name: tert-butyl 2-[2,6-dimethyl-4-[(E)-3-[4-(methylamino)phenyl]-3-oxoprop-1-enyl]phenoxy]-2-methylpropanoate. InChIKey: JMNQFYWMYKSSSA-NTEUORMPSA-N.
| Molecular formula | C26H33NO4 |
|---|---|
| Molecular weight | 423.5 g/mol |
| IUPAC name | tert-butyl 2-[2,6-dimethyl-4-[(E)-3-[4-(methylamino)phenyl]-3-oxoprop-1-enyl]phenoxy]-2-methylpropanoate |
| InChIKey | JMNQFYWMYKSSSA-NTEUORMPSA-N |
| SMILES | CC1=CC(=CC(=C1OC(C)(C)C(=O)OC(C)(C)C)C)/C=C/C(=O)C2=CC=C(C=C2)NC |
Computed by PubChem (NCBI)
Synonyms:
Anti-NASH agent 1, Anti-NASH agent 1?